C20H32O8 — CID 21124801
(1R,2S,3R,6R,8S,10S,11R,14R,15R,17R)-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecane-2,3,4,10,11,15,17-heptol (PubChem CID 21124801) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is (1R,2S,3R,6R,8S,10S,11R,14R,15R,17R)-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecane-2,3,4,10,11,15,17-heptol.
| Compound Name | (1R,2S,3R,6R,8S,10S,11R,14R,15R,17R)-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecane-2,3,4,10,11,15,17-heptol |
|---|---|
| PubChem CID | 21124801 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (1R,2S,3R,6R,8S,10S,11R,14R,15R,17R)-5,5,10,15-tetramethyl-7-oxapentacyclo[12.2.1.01,11.04,9.06,8]heptadecane-2,3,4,10,11,15,17-heptol |
| SMILES | CC1(C)[C@H]2O[C@H]2C2C1(O)[C@H](O)[C@@H](O)[C@]13C[C@@](C)(O)[C@H](CC[C@]1(O)C2(C)O)[C@H]3O |
| InChI | InChI=1S/C20H32O8/c1-15(2)14-9(28-14)10-17(4,25)19(26)6-5-8-11(21)18(19,7-16(8,3)24)12(22)13(23)20(10,15)27/h8-14,21-27H,5-7H2,1-4H3/t8-,9+,10?,11-,12-,13-,14+,16-,17?,18-,19+,20?/m1/s1 |
| InChIKey | XSEQBUVOXWTHGU-SSZKPSDGSA-N |
| XLogP | -1.73 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|