C15H19FN2O18P2-4 — CID 21126612
[(1S,2R,3S,4R)-1-carboxy-4-fluoro-1-hydroxy-5-oxo-2-phosphonatooxypentan-3-yl] phosphate;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 21126612) has the molecular formula C15H19FN2O18P2-4 and a molecular weight of 596.26 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-1-carboxy-4-fluoro-1-hydroxy-5-oxo-2-phosphonatooxypentan-3-yl] phosphate;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | [(1S,2R,3S,4R)-1-carboxy-4-fluoro-1-hydroxy-5-oxo-2-phosphonatooxypentan-3-yl] phosphate;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21126612 |
| Molecular Formula | C15H19FN2O18P2-4 |
| Molecular Weight | 596.26 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | [(1S,2R,3S,4R)-1-carboxy-4-fluoro-1-hydroxy-5-oxo-2-phosphonatooxypentan-3-yl] phosphate;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=C[C@H](F)[C@@H](OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@H](O)C(=O)O.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.C6H11FO12P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-2(1-8)4(18-20(12,13)14)5(3(9)6(10)11)19-21(15,16)17/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);1-5,9H,(H,10,11)(H2,12,13,14)(H2,15,16,17)/p-4/t4-,6-,7-,8-;2-,3-,4+,5+/m10/s1 |
| InChIKey | AJGKNFFJTKZJTA-OQYUZHDKSA-J |
| XLogP | -7.46 |
| TPSA | 344.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.26 |
| LogP ≤ 5 | -7.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|