C22H28ClN — CID 21126838
N,N-diethyl-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride (PubChem CID 21126838) has the molecular formula C22H28ClN and a molecular weight of 341.93 g/mol. Its IUPAC name is N,N-diethyl-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride.
| Compound Name | N,N-diethyl-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 21126838 |
| Molecular Formula | C22H28ClN |
| Molecular Weight | 341.93 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N,N-diethyl-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride |
| SMILES | CCN(CC)CCC1CC2c3ccccc3C1c1ccccc12.Cl |
| InChI | InChI=1S/C22H27N.ClH/c1-3-23(4-2)14-13-16-15-21-17-9-5-7-11-19(17)22(16)20-12-8-6-10-18(20)21;/h5-12,16,21-22H,3-4,13-15H2,1-2H3;1H |
| InChIKey | PQYRHUWTOZHJOI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.93 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |