C21H24N4O — CID 21129460
1-phenyl-3-[2-(2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)ethyl]urea (PubChem CID 21129460) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-phenyl-3-[2-(2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)ethyl]urea.
| Compound Name | 1-phenyl-3-[2-(2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)ethyl]urea |
|---|---|
| PubChem CID | 21129460 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-phenyl-3-[2-(2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)ethyl]urea |
| SMILES | O=C(NCCn1c2c(c3ccccc31)CCNCC2)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N4O/c26-21(24-16-6-2-1-3-7-16)23-14-15-25-19-9-5-4-8-17(19)18-10-12-22-13-11-20(18)25/h1-9,22H,10-15H2,(H2,23,24,26) |
| InChIKey | PXCMVXPXWUETLK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|