C13H15F3N2S — CID 21129868
3-(5-tert-butylthiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 21129868) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is 3-(5-tert-butylthiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 3-(5-tert-butylthiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 21129868 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-(5-tert-butylthiophen-2-yl)-1-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(-c2ccc(C(C)(C)C)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2S/c1-12(2,3)11-6-5-9(19-11)8-7-10(13(14,15)16)18(4)17-8/h5-7H,1-4H3 |
| InChIKey | YRMKVMQGUSYMTG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |