C20H14O5 — CID 21130962
1-[4-(1-hydroxy-3-oxobut-1-enyl)phenoxy]hepta-1,2,3,4,5,6-hexaenyl prop-2-enoate (PubChem CID 21130962) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-[4-(1-hydroxy-3-oxobut-1-enyl)phenoxy]hepta-1,2,3,4,5,6-hexaenyl prop-2-enoate.
| Compound Name | 1-[4-(1-hydroxy-3-oxobut-1-enyl)phenoxy]hepta-1,2,3,4,5,6-hexaenyl prop-2-enoate |
|---|---|
| PubChem CID | 21130962 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-[4-(1-hydroxy-3-oxobut-1-enyl)phenoxy]hepta-1,2,3,4,5,6-hexaenyl prop-2-enoate |
| SMILES | C=C=C=C=C=C=C(OC(=O)C=C)Oc1ccc(C(O)=CC(C)=O)cc1 |
| InChI | InChI=1S/C20H14O5/c1-4-6-7-8-9-20(25-19(23)5-2)24-17-12-10-16(11-13-17)18(22)14-15(3)21/h5,10-14,22H,1-2H2,3H3 |
| InChIKey | BRHSEHOZHNTWAE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|