C39H30O8 — CID 118423679
[4-(1-prop-2-enoyloxyhexa-1,2,3,4,5-pentaenyl)phenyl] 4-[[4-[6-(2-methylprop-2-enoyloxy)hexa-1,3,5-triynyl]phenoxy]methoxy]cyclohexane-1-carboxylate (PubChem CID 118423679) has the molecular formula C39H30O8 and a molecular weight of 626.66 g/mol. Its IUPAC name is [4-(1-prop-2-enoyloxyhexa-1,2,3,4,5-pentaenyl)phenyl] 4-[[4-[6-(2-methylprop-2-enoyloxy)hexa-1,3,5-triynyl]phenoxy]methoxy]cyclohexane-1-carboxylate.
| Compound Name | [4-(1-prop-2-enoyloxyhexa-1,2,3,4,5-pentaenyl)phenyl] 4-[[4-[6-(2-methylprop-2-enoyloxy)hexa-1,3,5-triynyl]phenoxy]methoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118423679 |
| Molecular Formula | C39H30O8 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | [4-(1-prop-2-enoyloxyhexa-1,2,3,4,5-pentaenyl)phenyl] 4-[[4-[6-(2-methylprop-2-enoyloxy)hexa-1,3,5-triynyl]phenoxy]methoxy]cyclohexane-1-carboxylate |
| SMILES | C=C=C=C=C=C(OC(=O)C=C)c1ccc(OC(=O)C2CCC(OCOc3ccc(C#CC#CC#COC(=O)C(=C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C39H30O8/c1-5-7-10-14-36(47-37(40)6-2)31-17-25-35(26-18-31)46-39(42)32-19-23-34(24-20-32)45-28-44-33-21-15-30(16-22-33)13-11-8-9-12-27-43-38(41)29(3)4/h6,15-18,21-22,25-26,32,34H,1-3,19-20,23-24,28H2,4H3 |
| InChIKey | ORAQLCMWMBPJNE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|