C15H21O13P — CID 21131014
1-[methyl(1,2,3-tricarboxybutyl)phosphoryl]butane-1,2,3-tricarboxylic acid (PubChem CID 21131014) has the molecular formula C15H21O13P and a molecular weight of 440.29 g/mol. Its IUPAC name is 1-[methyl(1,2,3-tricarboxybutyl)phosphoryl]butane-1,2,3-tricarboxylic acid.
| Compound Name | 1-[methyl(1,2,3-tricarboxybutyl)phosphoryl]butane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 21131014 |
| Molecular Formula | C15H21O13P |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-[methyl(1,2,3-tricarboxybutyl)phosphoryl]butane-1,2,3-tricarboxylic acid |
| SMILES | CC(C(=O)O)C(C(=O)O)C(C(=O)O)P(C)(=O)C(C(=O)O)C(C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C15H21O13P/c1-4(10(16)17)6(12(20)21)8(14(24)25)29(3,28)9(15(26)27)7(13(22)23)5(2)11(18)19/h4-9H,1-3H3,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | OSSWYSRNZSTKCV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 240.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|