C15H19O15P — CID 21131015
1-[methyl(1,2,3-tricarboxypropyl)phosphoryl]butane-1,2,3,4-tetracarboxylic acid (PubChem CID 21131015) has the molecular formula C15H19O15P and a molecular weight of 470.28 g/mol. Its IUPAC name is 1-[methyl(1,2,3-tricarboxypropyl)phosphoryl]butane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1-[methyl(1,2,3-tricarboxypropyl)phosphoryl]butane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 21131015 |
| Molecular Formula | C15H19O15P |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-[methyl(1,2,3-tricarboxypropyl)phosphoryl]butane-1,2,3,4-tetracarboxylic acid |
| SMILES | CP(=O)(C(C(=O)O)C(CC(=O)O)C(=O)O)C(C(=O)O)C(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H19O15P/c1-31(30,9(14(26)27)5(12(22)23)3-7(18)19)10(15(28)29)8(13(24)25)4(11(20)21)2-6(16)17/h4-5,8-10H,2-3H2,1H3,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | UZCXQPDZBFSKOV-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 278.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|