C30H19F6NO — CID 21135243
3-[3,5-bis(trifluoromethyl)phenyl]-8-phenanthren-9-yl-2,4-dihydro-1,3-benzoxazine (PubChem CID 21135243) has the molecular formula C30H19F6NO and a molecular weight of 523.48 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-8-phenanthren-9-yl-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-8-phenanthren-9-yl-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 21135243 |
| Molecular Formula | C30H19F6NO |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-8-phenanthren-9-yl-2,4-dihydro-1,3-benzoxazine |
| SMILES | FC(F)(F)c1cc(N2COc3c(cccc3-c3cc4ccccc4c4ccccc34)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H19F6NO/c31-29(32,33)20-13-21(30(34,35)36)15-22(14-20)37-16-19-7-5-11-26(28(19)38-17-37)27-12-18-6-1-2-8-23(18)24-9-3-4-10-25(24)27/h1-15H,16-17H2 |
| InChIKey | SJDUFBNOLLPJML-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|