C19H28N2O4S2 — CID 21139431
N-(2-hydroxysulfonothioyloxyethyl)-5-(4-propylquinolin-2-yl)oxypentan-1-amine (PubChem CID 21139431) has the molecular formula C19H28N2O4S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-(2-hydroxysulfonothioyloxyethyl)-5-(4-propylquinolin-2-yl)oxypentan-1-amine.
| Compound Name | N-(2-hydroxysulfonothioyloxyethyl)-5-(4-propylquinolin-2-yl)oxypentan-1-amine |
|---|---|
| PubChem CID | 21139431 |
| Molecular Formula | C19H28N2O4S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-(2-hydroxysulfonothioyloxyethyl)-5-(4-propylquinolin-2-yl)oxypentan-1-amine |
| SMILES | CCCc1cc(OCCCCCNCCOS(=O)(O)=S)nc2ccccc12 |
| InChI | InChI=1S/C19H28N2O4S2/c1-2-8-16-15-19(21-18-10-5-4-9-17(16)18)24-13-7-3-6-11-20-12-14-25-27(22,23)26/h4-5,9-10,15,20H,2-3,6-8,11-14H2,1H3,(H,22,23,26) |
| InChIKey | PVXVGENMKLYLKS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|