C19H30N2O5S2 — CID 90472477
2-[5-(4-propylquinolin-2-yl)oxypentylamino]ethanethiol;sulfuric acid (PubChem CID 90472477) has the molecular formula C19H30N2O5S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[5-(4-propylquinolin-2-yl)oxypentylamino]ethanethiol;sulfuric acid.
| Compound Name | 2-[5-(4-propylquinolin-2-yl)oxypentylamino]ethanethiol;sulfuric acid |
|---|---|
| PubChem CID | 90472477 |
| Molecular Formula | C19H30N2O5S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[5-(4-propylquinolin-2-yl)oxypentylamino]ethanethiol;sulfuric acid |
| SMILES | CCCc1cc(OCCCCCNCCS)nc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C19H28N2OS.H2O4S/c1-2-8-16-15-19(21-18-10-5-4-9-17(16)18)22-13-7-3-6-11-20-12-14-23;1-5(2,3)4/h4-5,9-10,15,20,23H,2-3,6-8,11-14H2,1H3;(H2,1,2,3,4) |
| InChIKey | DWCKTEYMDWBYPJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|