C16H17NO5S — CID 21141292
N-hydroxy-2-[(3-methoxycarbonyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylsulfinyl]benzeneamine oxide (PubChem CID 21141292) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is N-hydroxy-2-[(3-methoxycarbonyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylsulfinyl]benzeneamine oxide.
| Compound Name | N-hydroxy-2-[(3-methoxycarbonyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylsulfinyl]benzeneamine oxide |
|---|---|
| PubChem CID | 21141292 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-hydroxy-2-[(3-methoxycarbonyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylsulfinyl]benzeneamine oxide |
| SMILES | COC(=O)C1=C(CS(=O)c2ccccc2[NH+]([O-])O)C2C=CC1C2 |
| InChI | InChI=1S/C16H17NO5S/c1-22-16(18)15-11-7-6-10(8-11)12(15)9-23(21)14-5-3-2-4-13(14)17(19)20/h2-7,10-11,17,19H,8-9H2,1H3 |
| InChIKey | CHSFJEASRXJJLB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|