C14H14N2O6S — CID 21141365
2-[2-(carboxymethylamino)phenyl]sulfonyl-N-hydroxybenzeneamine oxide (PubChem CID 21141365) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[2-(carboxymethylamino)phenyl]sulfonyl-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[2-(carboxymethylamino)phenyl]sulfonyl-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21141365 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[2-(carboxymethylamino)phenyl]sulfonyl-N-hydroxybenzeneamine oxide |
| SMILES | O=C(O)CNc1ccccc1S(=O)(=O)c1ccccc1[NH+]([O-])O |
| InChI | InChI=1S/C14H14N2O6S/c17-14(18)9-15-10-5-1-3-7-12(10)23(21,22)13-8-4-2-6-11(13)16(19)20/h1-8,15-16,19H,9H2,(H,17,18) |
| InChIKey | BEZXEUBYKISCHG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|