C15H16N2O3 — CID 21142511
N-hydroxy-6-methoxy-1,4-dimethyl-9H-carbazol-3-amine oxide (PubChem CID 21142511) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-hydroxy-6-methoxy-1,4-dimethyl-9H-carbazol-3-amine oxide.
| Compound Name | N-hydroxy-6-methoxy-1,4-dimethyl-9H-carbazol-3-amine oxide |
|---|---|
| PubChem CID | 21142511 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-hydroxy-6-methoxy-1,4-dimethyl-9H-carbazol-3-amine oxide |
| SMILES | COc1ccc2[nH]c3c(C)cc([NH+]([O-])O)c(C)c3c2c1 |
| InChI | InChI=1S/C15H16N2O3/c1-8-6-13(17(18)19)9(2)14-11-7-10(20-3)4-5-12(11)16-15(8)14/h4-7,16-18H,1-3H3 |
| InChIKey | RNEMGLSMLROZJU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|