C15H15N2O3- — CID 21142512
N-(6-methoxy-1,4-dimethyl-9H-carbazol-3-yl)-N-oxidohydroxylamine (PubChem CID 21142512) has the molecular formula C15H15N2O3- and a molecular weight of 271.30 g/mol. Its IUPAC name is N-(6-methoxy-1,4-dimethyl-9H-carbazol-3-yl)-N-oxidohydroxylamine.
| Compound Name | N-(6-methoxy-1,4-dimethyl-9H-carbazol-3-yl)-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 21142512 |
| Molecular Formula | C15H15N2O3- |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(6-methoxy-1,4-dimethyl-9H-carbazol-3-yl)-N-oxidohydroxylamine |
| SMILES | COc1ccc2[nH]c3c(C)cc(N([O-])O)c(C)c3c2c1 |
| InChI | InChI=1S/C15H15N2O3/c1-8-6-13(17(18)19)9(2)14-11-7-10(20-3)4-5-12(11)16-15(8)14/h4-7,16,18H,1-3H3/q-1 |
| InChIKey | IMAKKFKWOJHVNC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|