C17H13BrClNO3 — CID 21144185
2-(3-bromoquinolin-1-ium-1-yl)-1-(3,4-dihydroxyphenyl)ethanone chloride (PubChem CID 21144185) has the molecular formula C17H13BrClNO3 and a molecular weight of 394.65 g/mol. Its IUPAC name is 2-(3-bromoquinolin-1-ium-1-yl)-1-(3,4-dihydroxyphenyl)ethanone chloride.
| Compound Name | 2-(3-bromoquinolin-1-ium-1-yl)-1-(3,4-dihydroxyphenyl)ethanone chloride |
|---|---|
| PubChem CID | 21144185 |
| Molecular Formula | C17H13BrClNO3 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2-(3-bromoquinolin-1-ium-1-yl)-1-(3,4-dihydroxyphenyl)ethanone chloride |
| SMILES | O=C(C[n+]1cc(Br)cc2ccccc21)c1ccc(O)c(O)c1.[Cl-] |
| InChI | InChI=1S/C17H12BrNO3.ClH/c18-13-7-11-3-1-2-4-14(11)19(9-13)10-17(22)12-5-6-15(20)16(21)8-12;/h1-9H,10H2,(H-,20,21,22);1H |
| InChIKey | PGUJZPYLIPLJNV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|