C20H22N2O — CID 21144831
(1S,4R,12R,13R,16R,18S)-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6,8,10-trien-19-one (PubChem CID 21144831) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (1S,4R,12R,13R,16R,18S)-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6,8,10-trien-19-one.
| Compound Name | (1S,4R,12R,13R,16R,18S)-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6,8,10-trien-19-one |
|---|---|
| PubChem CID | 21144831 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1S,4R,12R,13R,16R,18S)-5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6,8,10-trien-19-one |
| SMILES | O=C1[C@H]2C[C@H]3CN4CCC[C@@]15CC[C@@]21Nc2ccccc2[C@@]31[C@@H]45 |
| InChI | InChI=1S/C20H22N2O/c23-16-14-10-12-11-22-9-3-6-18(16)7-8-19(14)20(12,17(18)22)13-4-1-2-5-15(13)21-19/h1-2,4-5,12,14,17,21H,3,6-11H2/t12-,14+,17-,18+,19+,20+/m0/s1 |
| InChIKey | FCUQDQSTYUOVJJ-KJWGDXGPSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |