C14H15NO — CID 138973755
(1S,10R,12R)-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one (PubChem CID 138973755) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is (1S,10R,12R)-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one.
| Compound Name | (1S,10R,12R)-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 138973755 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (1S,10R,12R)-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one |
| SMILES | O=C1Nc2ccccc2[C@@]23CCC[C@@H]2C[C@@H]13 |
| InChI | InChI=1S/C14H15NO/c16-13-11-8-9-4-3-7-14(9,11)10-5-1-2-6-12(10)15-13/h1-2,5-6,9,11H,3-4,7-8H2,(H,15,16)/t9-,11+,14-/m1/s1 |
| InChIKey | LJLWNCLJTHEVPP-OLUVUFQESA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |