C13H13NO2 — CID 138973145
(1R,10R,12R)-14-oxa-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one (PubChem CID 138973145) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (1R,10R,12R)-14-oxa-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one.
| Compound Name | (1R,10R,12R)-14-oxa-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 138973145 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (1R,10R,12R)-14-oxa-8-azatetracyclo[8.5.0.01,12.02,7]pentadeca-2,4,6-trien-9-one |
| SMILES | O=C1Nc2ccccc2[C@@]23COC[C@@H]2C[C@@H]13 |
| InChI | InChI=1S/C13H13NO2/c15-12-10-5-8-6-16-7-13(8,10)9-3-1-2-4-11(9)14-12/h1-4,8,10H,5-7H2,(H,14,15)/t8-,10-,13+/m0/s1 |
| InChIKey | KNCKPLGHDRRNPU-GMOODISLSA-N |
| XLogP | 1.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |