C21H24N2O — CID 52937903
(1R,10S,13S)-12,12-bis(ethenyl)-14-prop-2-enyl-8,14-diazatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-9-one (PubChem CID 52937903) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (1R,10S,13S)-12,12-bis(ethenyl)-14-prop-2-enyl-8,14-diazatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-9-one.
| Compound Name | (1R,10S,13S)-12,12-bis(ethenyl)-14-prop-2-enyl-8,14-diazatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 52937903 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (1R,10S,13S)-12,12-bis(ethenyl)-14-prop-2-enyl-8,14-diazatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-trien-9-one |
| SMILES | C=CCN1CC[C@]23c4ccccc4NC(=O)[C@H]2CC(C=C)(C=C)[C@H]13 |
| InChI | InChI=1S/C21H24N2O/c1-4-12-23-13-11-21-15-9-7-8-10-17(15)22-18(24)16(21)14-20(5-2,6-3)19(21)23/h4-10,16,19H,1-3,11-14H2,(H,22,24)/t16-,19+,21+/m1/s1 |
| InChIKey | SROJXMXZPXUNKN-PBEJRMEISA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|