C30H42Cl2N2 — CID 21146
benzyl-[2-[3-[1-[benzyl(dimethyl)azaniumyl]propan-2-yl]phenyl]propyl]-dimethylazanium dichloride (PubChem CID 21146) has the molecular formula C30H42Cl2N2 and a molecular weight of 501.59 g/mol. Its IUPAC name is benzyl-[2-[3-[1-[benzyl(dimethyl)azaniumyl]propan-2-yl]phenyl]propyl]-dimethylazanium dichloride.
| Compound Name | benzyl-[2-[3-[1-[benzyl(dimethyl)azaniumyl]propan-2-yl]phenyl]propyl]-dimethylazanium dichloride |
|---|---|
| PubChem CID | 21146 |
| Molecular Formula | C30H42Cl2N2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | benzyl-[2-[3-[1-[benzyl(dimethyl)azaniumyl]propan-2-yl]phenyl]propyl]-dimethylazanium dichloride |
| SMILES | CC(C[N+](C)(C)Cc1ccccc1)c1cccc(C(C)C[N+](C)(C)Cc2ccccc2)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C30H42N2.2ClH/c1-25(21-31(3,4)23-27-14-9-7-10-15-27)29-18-13-19-30(20-29)26(2)22-32(5,6)24-28-16-11-8-12-17-28;;/h7-20,25-26H,21-24H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | ZFMLJYPZGZCZAJ-UHFFFAOYSA-L |
| XLogP | 0.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|