C33H51N3O4 — CID 21147420
(4aS,8aS)-2-[3-[5-benzyl-2-oxo-3-(oxolan-3-ylmethyl)pyrrolidin-1-yl]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 21147420) has the molecular formula C33H51N3O4 and a molecular weight of 553.79 g/mol. Its IUPAC name is (4aS,8aS)-2-[3-[5-benzyl-2-oxo-3-(oxolan-3-ylmethyl)pyrrolidin-1-yl]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (4aS,8aS)-2-[3-[5-benzyl-2-oxo-3-(oxolan-3-ylmethyl)pyrrolidin-1-yl]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 21147420 |
| Molecular Formula | C33H51N3O4 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.39 |
| IUPAC Name | (4aS,8aS)-2-[3-[5-benzyl-2-oxo-3-(oxolan-3-ylmethyl)pyrrolidin-1-yl]-2-hydroxypropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1C[C@@H]2CCCC[C@@H]2CN1CC(O)CN1C(=O)C(CC2CCOC2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C33H51N3O4/c1-33(2,3)34-31(38)30-18-25-11-7-8-12-26(25)19-35(30)20-29(37)21-36-28(16-23-9-5-4-6-10-23)17-27(32(36)39)15-24-13-14-40-22-24/h4-6,9-10,24-30,37H,7-8,11-22H2,1-3H3,(H,34,38)/t24?,25-,26+,27?,28?,29?,30?/m0/s1 |
| InChIKey | WOZKUAWHOBVDFG-AUDPROITSA-N |
| XLogP | 4.03 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |