C18H18NO7S- — CID 21148839
N-[(E)-3-(benzenesulfonyl)-2-[6-(methoxymethyl)-1,3-benzodioxol-5-yl]prop-1-enyl]-N-oxidohydroxylamine (PubChem CID 21148839) has the molecular formula C18H18NO7S- and a molecular weight of 392.41 g/mol. Its IUPAC name is N-[(E)-3-(benzenesulfonyl)-2-[6-(methoxymethyl)-1,3-benzodioxol-5-yl]prop-1-enyl]-N-oxidohydroxylamine.
| Compound Name | N-[(E)-3-(benzenesulfonyl)-2-[6-(methoxymethyl)-1,3-benzodioxol-5-yl]prop-1-enyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 21148839 |
| Molecular Formula | C18H18NO7S- |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[(E)-3-(benzenesulfonyl)-2-[6-(methoxymethyl)-1,3-benzodioxol-5-yl]prop-1-enyl]-N-oxidohydroxylamine |
| SMILES | COCc1cc2c(cc1/C(=C\N([O-])O)CS(=O)(=O)c1ccccc1)OCO2 |
| InChI | InChI=1S/C18H18NO7S/c1-24-10-13-7-17-18(26-12-25-17)8-16(13)14(9-19(20)21)11-27(22,23)15-5-3-2-4-6-15/h2-9,20H,10-12H2,1H3/q-1/b14-9- |
| InChIKey | DJKRAMCGJKSJPN-ZROIWOOFSA-N |
| XLogP | 2.57 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|