C10H13ClN2O2S2 — CID 21150798
(4-chlorophenyl)methyl N-(dimethylaminodisulfanyl)carbamate (PubChem CID 21150798) has the molecular formula C10H13ClN2O2S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is (4-chlorophenyl)methyl N-(dimethylaminodisulfanyl)carbamate.
| Compound Name | (4-chlorophenyl)methyl N-(dimethylaminodisulfanyl)carbamate |
|---|---|
| PubChem CID | 21150798 |
| Molecular Formula | C10H13ClN2O2S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (4-chlorophenyl)methyl N-(dimethylaminodisulfanyl)carbamate |
| SMILES | CN(C)SSNC(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClN2O2S2/c1-13(2)17-16-12-10(14)15-7-8-3-5-9(11)6-4-8/h3-6H,7H2,1-2H3,(H,12,14) |
| InChIKey | CUHCOGLFBCWKDP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|