C29H27NO — CID 21152102
(Z)-3-(3,4-dihydronaphthalen-2-yl)-2,3-diphenyl-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 21152102) has the molecular formula C29H27NO and a molecular weight of 405.54 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydronaphthalen-2-yl)-2,3-diphenyl-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | (Z)-3-(3,4-dihydronaphthalen-2-yl)-2,3-diphenyl-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 21152102 |
| Molecular Formula | C29H27NO |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (Z)-3-(3,4-dihydronaphthalen-2-yl)-2,3-diphenyl-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C(=C(/C1=Cc2ccccc2CC1)c1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C29H27NO/c31-29(30-19-9-10-20-30)28(24-14-5-2-6-15-24)27(23-12-3-1-4-13-23)26-18-17-22-11-7-8-16-25(22)21-26/h1-8,11-16,21H,9-10,17-20H2/b28-27+ |
| InChIKey | KYXQBPWGQOXNKL-BYYHNAKLSA-N |
| XLogP | 6.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|