C24H30Br2N2 — CID 21152353
3-(4-benzhydrylpyridin-1-ium-1-yl)-N,N-dimethylpropan-1-amine;bromomethane;bromide (PubChem CID 21152353) has the molecular formula C24H30Br2N2 and a molecular weight of 506.33 g/mol. Its IUPAC name is 3-(4-benzhydrylpyridin-1-ium-1-yl)-N,N-dimethylpropan-1-amine;bromomethane;bromide.
| Compound Name | 3-(4-benzhydrylpyridin-1-ium-1-yl)-N,N-dimethylpropan-1-amine;bromomethane;bromide |
|---|---|
| PubChem CID | 21152353 |
| Molecular Formula | C24H30Br2N2 |
| Molecular Weight | 506.33 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 3-(4-benzhydrylpyridin-1-ium-1-yl)-N,N-dimethylpropan-1-amine;bromomethane;bromide |
| SMILES | CBr.CN(C)CCC[n+]1ccc(C(c2ccccc2)c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C23H27N2.CH3Br.BrH/c1-24(2)16-9-17-25-18-14-22(15-19-25)23(20-10-5-3-6-11-20)21-12-7-4-8-13-21;1-2;/h3-8,10-15,18-19,23H,9,16-17H2,1-2H3;1H3;1H/q+1;;/p-1 |
| InChIKey | IVZYUCSUHUZQND-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|