C15H20N2O — CID 21153560
N-methyl-1-(3-methylphenyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-imine (PubChem CID 21153560) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-methyl-1-(3-methylphenyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-imine.
| Compound Name | N-methyl-1-(3-methylphenyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-imine |
|---|---|
| PubChem CID | 21153560 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-methyl-1-(3-methylphenyl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-imine |
| SMILES | C/N=C1\OC(c2cccc(C)c2)C2CCCCN12 |
| InChI | InChI=1S/C15H20N2O/c1-11-6-5-7-12(10-11)14-13-8-3-4-9-17(13)15(16-2)18-14/h5-7,10,13-14H,3-4,8-9H2,1-2H3/b16-15- |
| InChIKey | SCNNXGVJNHRCCK-NXVVXOECSA-N |
| XLogP | 2.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|