C14H18N2S — CID 3051200
(1R,8aS)-N-methyl-1-phenyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine (PubChem CID 3051200) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is (1R,8aS)-N-methyl-1-phenyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine.
| Compound Name | (1R,8aS)-N-methyl-1-phenyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine |
|---|---|
| PubChem CID | 3051200 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (1R,8aS)-N-methyl-1-phenyl-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridin-3-imine |
| SMILES | C/N=C1\S[C@H](c2ccccc2)[C@@H]2CCCCN12 |
| InChI | InChI=1S/C14H18N2S/c1-15-14-16-10-6-5-9-12(16)13(17-14)11-7-3-2-4-8-11/h2-4,7-8,12-13H,5-6,9-10H2,1H3/b15-14-/t12-,13+/m0/s1 |
| InChIKey | KLHLLGKKUCDJBE-JAZJYCRLSA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|