C22H28ClNO2 — CID 21153796
2-[2-(1-phenylethyl)piperidin-1-yl]ethyl benzoate;hydrochloride (PubChem CID 21153796) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is 2-[2-(1-phenylethyl)piperidin-1-yl]ethyl benzoate;hydrochloride.
| Compound Name | 2-[2-(1-phenylethyl)piperidin-1-yl]ethyl benzoate;hydrochloride |
|---|---|
| PubChem CID | 21153796 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[2-(1-phenylethyl)piperidin-1-yl]ethyl benzoate;hydrochloride |
| SMILES | CC(c1ccccc1)C1CCCCN1CCOC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C22H27NO2.ClH/c1-18(19-10-4-2-5-11-19)21-14-8-9-15-23(21)16-17-25-22(24)20-12-6-3-7-13-20;/h2-7,10-13,18,21H,8-9,14-17H2,1H3;1H |
| InChIKey | KCCYIPPEMSWQSX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |