C23H17ClN2O4 — CID 21155109
2-[3-(4-chlorophenyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetic acid (PubChem CID 21155109) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[3-(4-chlorophenyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 21155109 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-2,5-dioxo-4,4-diphenylimidazolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)N(c2ccc(Cl)cc2)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H17ClN2O4/c24-18-11-13-19(14-12-18)26-22(30)25(15-20(27)28)21(29)23(26,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H,15H2,(H,27,28) |
| InChIKey | XRIBQKOWZKPELG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|