C21H21NO4S — CID 21157509
ethyl 2-[(E)-(1,3-dioxoinden-2-yl)methylideneamino]-4-(2-methylpropyl)thiophene-3-carboxylate (PubChem CID 21157509) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 2-[(E)-(1,3-dioxoinden-2-yl)methylideneamino]-4-(2-methylpropyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(E)-(1,3-dioxoinden-2-yl)methylideneamino]-4-(2-methylpropyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 21157509 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl 2-[(E)-(1,3-dioxoinden-2-yl)methylideneamino]-4-(2-methylpropyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC(C)C)csc1/N=C/C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H21NO4S/c1-4-26-21(25)17-13(9-12(2)3)11-27-20(17)22-10-16-18(23)14-7-5-6-8-15(14)19(16)24/h5-8,10-12,16H,4,9H2,1-3H3/b22-10+ |
| InChIKey | AAMSYBLEZSOPLA-LSHDLFTRSA-N |
| XLogP | 4.52 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|