About CID 21159496
CID 21159496 (PubChem CID 21159496) has the molecular formula C25H32OSi
and a molecular weight of 376.62 g/mol.
Molecular Properties
| Compound Name | CID 21159496 |
| PubChem CID | 21159496 |
| Molecular Formula | C25H32OSi |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C/CO[Si]/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32OSi/c1-2-3-4-5-6-7-8-9-16-21-26-27-25(24-19-14-11-15-20-24)22-23-17-12-10-13-18-23/h9-20,22H,2-8,21H2,1H3/b16-9+,25-22- |
| InChIKey | VOVCKQDBUXHSTA-MECZOEAZSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 21159496 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21159496?
The IUPAC name of CID 21159496 (CID 21159496) is not available.
What is the SMILES notation for CID 21159496?
The canonical SMILES for CID 21159496 is CCCCCCCC/C=C/CO[Si]/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of CID 21159496?
The InChIKey is VOVCKQDBUXHSTA-MECZOEAZSA-N. The full InChI is InChI=1S/C25H32OSi/c1-2-3-4-5-6-7-8-9-16-21-26-27-25(24-19-14-11-15-20-24)22-23-17-12-10-13-18-23/h9-20,22H,2-8,21H2,1H3/b16-9+,25-22-.
What are the key properties of CID 21159496?
CID 21159496 has a molecular weight of 376.62 g/mol, XLogP of 7.13, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21159496 is sourced from PubChem (CID 21159496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).