C20H25P — CID 70146049
1,2-diphenylethenyl(hexyl)phosphane (PubChem CID 70146049) has the molecular formula C20H25P and a molecular weight of 296.39 g/mol. Its IUPAC name is 1,2-diphenylethenyl(hexyl)phosphane.
| Compound Name | 1,2-diphenylethenyl(hexyl)phosphane |
|---|---|
| PubChem CID | 70146049 |
| Molecular Formula | C20H25P |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1,2-diphenylethenyl(hexyl)phosphane |
| SMILES | CCCCCCPC(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25P/c1-2-3-4-11-16-21-20(19-14-9-6-10-15-19)17-18-12-7-5-8-13-18/h5-10,12-15,17,21H,2-4,11,16H2,1H3 |
| InChIKey | ZVIBTRFXJHAPJI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|