C10H10BrN3S2 — CID 21178741
1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-yl)thiourea (PubChem CID 21178741) has the molecular formula C10H10BrN3S2 and a molecular weight of 316.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 21178741 |
| Molecular Formula | C10H10BrN3S2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4,5-dihydro-1,3-thiazol-2-yl)thiourea |
| SMILES | S=C(NC1=NCCS1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H10BrN3S2/c11-7-1-3-8(4-2-7)13-9(15)14-10-12-5-6-16-10/h1-4H,5-6H2,(H2,12,13,14,15) |
| InChIKey | SNMCHQAXRXTUIK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|