C11H10FN3OS2 — CID 833913
N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-2-fluorobenzamide (PubChem CID 833913) has the molecular formula C11H10FN3OS2 and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-2-fluorobenzamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 833913 |
| Molecular Formula | C11H10FN3OS2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-2-fluorobenzamide |
| SMILES | O=C(NC(=S)NC1=NCCS1)c1ccccc1F |
| InChI | InChI=1S/C11H10FN3OS2/c12-8-4-2-1-3-7(8)9(16)14-10(17)15-11-13-5-6-18-11/h1-4H,5-6H2,(H2,13,14,15,16,17) |
| InChIKey | XIBUETZXELKEQN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|