C23H21NO3 — CID 21180851
2-(3-formyl-4-phenylpyrrolidin-1-yl)-2-naphthalen-1-ylacetic acid (PubChem CID 21180851) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(3-formyl-4-phenylpyrrolidin-1-yl)-2-naphthalen-1-ylacetic acid.
| Compound Name | 2-(3-formyl-4-phenylpyrrolidin-1-yl)-2-naphthalen-1-ylacetic acid |
|---|---|
| PubChem CID | 21180851 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-(3-formyl-4-phenylpyrrolidin-1-yl)-2-naphthalen-1-ylacetic acid |
| SMILES | O=CC1CN(C(C(=O)O)c2cccc3ccccc23)CC1c1ccccc1 |
| InChI | InChI=1S/C23H21NO3/c25-15-18-13-24(14-21(18)17-7-2-1-3-8-17)22(23(26)27)20-12-6-10-16-9-4-5-11-19(16)20/h1-12,15,18,21-22H,13-14H2,(H,26,27) |
| InChIKey | YOZUMIZRYOWZDR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|