C19H15Br2FN3OS- — CID 21203055
4-bromo-N-[(Z)-[4-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]benzamide bromide (PubChem CID 21203055) has the molecular formula C19H15Br2FN3OS- and a molecular weight of 512.22 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-[4-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]benzamide bromide.
| Compound Name | 4-bromo-N-[(Z)-[4-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]benzamide bromide |
|---|---|
| PubChem CID | 21203055 |
| Molecular Formula | C19H15Br2FN3OS- |
| Molecular Weight | 512.22 g/mol |
| Exact Mass | 509.93 |
| IUPAC Name | 4-bromo-N-[(Z)-[4-(4-fluorophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]amino]benzamide bromide |
| SMILES | C=CCn1c(-c2ccc(F)cc2)cs/c1=N\NC(=O)c1ccc(Br)cc1.[Br-] |
| InChI | InChI=1S/C19H15BrFN3OS.BrH/c1-2-11-24-17(13-5-9-16(21)10-6-13)12-26-19(24)23-22-18(25)14-3-7-15(20)8-4-14;/h2-10,12H,1,11H2,(H,22,25);1H/p-1/b23-19-; |
| InChIKey | RUDVPYINOPDJBJ-PDEWKSAASA-M |
| XLogP | 1.55 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|