C18H9FN4O2 — CID 21204489
13-fluoro-1,3,11,15-tetrazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4,6,8,12,14,16,18,20-nonaene-10,22-dione (PubChem CID 21204489) has the molecular formula C18H9FN4O2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 13-fluoro-1,3,11,15-tetrazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4,6,8,12,14,16,18,20-nonaene-10,22-dione.
| Compound Name | 13-fluoro-1,3,11,15-tetrazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4,6,8,12,14,16,18,20-nonaene-10,22-dione |
|---|---|
| PubChem CID | 21204489 |
| Molecular Formula | C18H9FN4O2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 13-fluoro-1,3,11,15-tetrazapentacyclo[12.8.0.02,11.04,9.016,21]docosa-2,4,6,8,12,14,16,18,20-nonaene-10,22-dione |
| SMILES | O=c1c2ccccc2nc2n1cc(F)c1nc3ccccc3c(=O)n12 |
| InChI | InChI=1S/C18H9FN4O2/c19-12-9-22-16(24)10-5-1-4-8-14(10)21-18(22)23-15(12)20-13-7-3-2-6-11(13)17(23)25/h1-9H |
| InChIKey | LLYYHCKHZMCLJH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|