C19H16IN3O2S — CID 21216515
N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 21216515) has the molecular formula C19H16IN3O2S and a molecular weight of 477.33 g/mol. Its IUPAC name is N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 21216515 |
| Molecular Formula | C19H16IN3O2S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NC(=S)Nc1ncc(I)cc1C |
| InChI | InChI=1S/C19H16IN3O2S/c1-11-7-14(20)10-21-17(11)22-19(26)23-18(24)15-8-12-5-3-4-6-13(12)9-16(15)25-2/h3-10H,1-2H3,(H2,21,22,23,24,26) |
| InChIKey | OHOBGSMWHNGBOZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|