C17H18IN3O4S — CID 4681073
N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 4681073) has the molecular formula C17H18IN3O4S and a molecular weight of 487.32 g/mol. Its IUPAC name is N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4681073 |
| Molecular Formula | C17H18IN3O4S |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ncc(I)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C17H18IN3O4S/c1-9-5-11(18)8-19-15(9)20-17(26)21-16(22)10-6-12(23-2)14(25-4)13(7-10)24-3/h5-8H,1-4H3,(H2,19,20,21,22,26) |
| InChIKey | RGHFILVSHVXFKT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|