C14H10Cl2IN3OS — CID 21216561
2,3-dichloro-N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]benzamide (PubChem CID 21216561) has the molecular formula C14H10Cl2IN3OS and a molecular weight of 466.13 g/mol. Its IUPAC name is 2,3-dichloro-N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21216561 |
| Molecular Formula | C14H10Cl2IN3OS |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 464.90 |
| IUPAC Name | 2,3-dichloro-N-[(5-iodo-3-methyl-2-pyridinyl)carbamothioyl]benzamide |
| SMILES | Cc1cc(I)cnc1NC(=S)NC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2IN3OS/c1-7-5-8(17)6-18-12(7)19-14(22)20-13(21)9-3-2-4-10(15)11(9)16/h2-6H,1H3,(H2,18,19,20,21,22) |
| InChIKey | HUZVZSRQSHIZNV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|