C8H4N4 — CID 21218270
3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 21218270) has the molecular formula C8H4N4 and a molecular weight of 156.15 g/mol. Its IUPAC name is 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 21218270 |
| Molecular Formula | C8H4N4 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(C#N)=C1C#N |
| InChI | InChI=1S/C8H4N4/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2,11-12H/b11-7+,12-8+ |
| InChIKey | VVSKASAVQVCYSR-MKICQXMISA-N |
| XLogP | 0.94 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|