About 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile
3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 21218270) has the molecular formula C8H4N4
and a molecular weight of 156.15 g/mol. Its IUPAC name is 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile |
| PubChem CID | 21218270 |
| Molecular Formula | C8H4N4 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(C#N)=C1C#N |
| InChI | InChI=1S/C8H4N4/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2,11-12H/b11-7+,12-8+ |
| InChIKey | VVSKASAVQVCYSR-MKICQXMISA-N |
| XLogP | 0.94 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile?
The IUPAC name of 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile (CID 21218270) is 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile.
What is the SMILES notation for 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile?
The canonical SMILES for 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile is [H]/N=C1\C=C/C(=N\[H])C(C#N)=C1C#N.
What is the InChIKey of 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile?
The InChIKey is VVSKASAVQVCYSR-MKICQXMISA-N. The full InChI is InChI=1S/C8H4N4/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2,11-12H/b11-7+,12-8+.
What are the key properties of 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile?
3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile has a molecular weight of 156.15 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diiminocyclohexa-1,4-diene-1,2-dicarbonitrile is sourced from PubChem (CID 21218270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).