C9H6N4 — CID 21218269
2,5-diimino-4-methylcyclohexa-3,6-diene-1,3-dicarbonitrile (PubChem CID 21218269) has the molecular formula C9H6N4 and a molecular weight of 170.18 g/mol. Its IUPAC name is 2,5-diimino-4-methylcyclohexa-3,6-diene-1,3-dicarbonitrile.
| Compound Name | 2,5-diimino-4-methylcyclohexa-3,6-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 21218269 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2,5-diimino-4-methylcyclohexa-3,6-diene-1,3-dicarbonitrile |
| SMILES | [H]/N=C1\C=C(C#N)/C(=N\[H])C(C#N)=C1C |
| InChI | InChI=1S/C9H6N4/c1-5-7(4-11)9(13)6(3-10)2-8(5)12/h2,12-13H,1H3/b12-8+,13-9+ |
| InChIKey | CVGZUHSYSLUBMS-QHKWOANTSA-N |
| XLogP | 1.33 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|