C23H21ClO4S — CID 21219594
4-[4-(4-chlorophenyl)phenyl]-4-hydroxy-2-[(4-hydroxyphenyl)sulfanylmethyl]butanoic acid (PubChem CID 21219594) has the molecular formula C23H21ClO4S and a molecular weight of 428.94 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)phenyl]-4-hydroxy-2-[(4-hydroxyphenyl)sulfanylmethyl]butanoic acid.
| Compound Name | 4-[4-(4-chlorophenyl)phenyl]-4-hydroxy-2-[(4-hydroxyphenyl)sulfanylmethyl]butanoic acid |
|---|---|
| PubChem CID | 21219594 |
| Molecular Formula | C23H21ClO4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-[4-(4-chlorophenyl)phenyl]-4-hydroxy-2-[(4-hydroxyphenyl)sulfanylmethyl]butanoic acid |
| SMILES | O=C(O)C(CSc1ccc(O)cc1)CC(O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H21ClO4S/c24-19-7-5-16(6-8-19)15-1-3-17(4-2-15)22(26)13-18(23(27)28)14-29-21-11-9-20(25)10-12-21/h1-12,18,22,25-26H,13-14H2,(H,27,28) |
| InChIKey | COYOBGWBJJGTLZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |