C15H15N5S — CID 21220783
14-[2-(methylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine (PubChem CID 21220783) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 14-[2-(methylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine.
| Compound Name | 14-[2-(methylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine |
|---|---|
| PubChem CID | 21220783 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 14-[2-(methylamino)ethyl]-8-thia-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-amine |
| SMILES | CNCCn1nc2c3c(c(N)ccc31)Sc1ccncc1-2 |
| InChI | InChI=1S/C15H15N5S/c1-17-6-7-20-11-3-2-10(16)15-13(11)14(19-20)9-8-18-5-4-12(9)21-15/h2-5,8,17H,6-7,16H2,1H3 |
| InChIKey | DCLIQIORFJMWAC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|