C18H36O7 — CID 21225087
[2-(2,3-dihydroxypropoxymethyl)-2-(hydroxymethyl)-3-octoxypropyl] acetate (PubChem CID 21225087) has the molecular formula C18H36O7 and a molecular weight of 364.48 g/mol. Its IUPAC name is [2-(2,3-dihydroxypropoxymethyl)-2-(hydroxymethyl)-3-octoxypropyl] acetate.
| Compound Name | [2-(2,3-dihydroxypropoxymethyl)-2-(hydroxymethyl)-3-octoxypropyl] acetate |
|---|---|
| PubChem CID | 21225087 |
| Molecular Formula | C18H36O7 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | [2-(2,3-dihydroxypropoxymethyl)-2-(hydroxymethyl)-3-octoxypropyl] acetate |
| SMILES | CCCCCCCCOCC(CO)(COCC(O)CO)COC(C)=O |
| InChI | InChI=1S/C18H36O7/c1-3-4-5-6-7-8-9-23-13-18(12-20,15-25-16(2)21)14-24-11-17(22)10-19/h17,19-20,22H,3-15H2,1-2H3 |
| InChIKey | WQRYQYLZMVWRGL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|