C12H6Cl2N6O — CID 21233910
2-azido-4,5-dichloro-6-(2-hydroxyanilino)pyridine-3-carbonitrile (PubChem CID 21233910) has the molecular formula C12H6Cl2N6O and a molecular weight of 321.13 g/mol. Its IUPAC name is 2-azido-4,5-dichloro-6-(2-hydroxyanilino)pyridine-3-carbonitrile.
| Compound Name | 2-azido-4,5-dichloro-6-(2-hydroxyanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 21233910 |
| Molecular Formula | C12H6Cl2N6O |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-azido-4,5-dichloro-6-(2-hydroxyanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N=[N+]=[N-])nc(Nc2ccccc2O)c(Cl)c1Cl |
| InChI | InChI=1S/C12H6Cl2N6O/c13-9-6(5-15)11(19-20-16)18-12(10(9)14)17-7-3-1-2-4-8(7)21/h1-4,21H,(H,17,18) |
| InChIKey | CVMVDTTYMMYUTL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|