C13H8Cl3N5S — CID 22308112
1-phenyl-1-[(3,4,6-trichloro-5-cyano-2-pyridinyl)amino]thiourea (PubChem CID 22308112) has the molecular formula C13H8Cl3N5S and a molecular weight of 372.67 g/mol. Its IUPAC name is 1-phenyl-1-[(3,4,6-trichloro-5-cyano-2-pyridinyl)amino]thiourea.
| Compound Name | 1-phenyl-1-[(3,4,6-trichloro-5-cyano-2-pyridinyl)amino]thiourea |
|---|---|
| PubChem CID | 22308112 |
| Molecular Formula | C13H8Cl3N5S |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 1-phenyl-1-[(3,4,6-trichloro-5-cyano-2-pyridinyl)amino]thiourea |
| SMILES | N#Cc1c(Cl)nc(NN(C(N)=S)c2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl3N5S/c14-9-8(6-17)11(16)19-12(10(9)15)20-21(13(18)22)7-4-2-1-3-5-7/h1-5H,(H2,18,22)(H,19,20) |
| InChIKey | OGSNKSINNALURM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|