C14H7Cl3N4O — CID 6252079
2,4,5-trichloro-6-[(2Z)-2-[(2-formylphenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile (PubChem CID 6252079) has the molecular formula C14H7Cl3N4O and a molecular weight of 353.60 g/mol. Its IUPAC name is 2,4,5-trichloro-6-[(2Z)-2-[(2-formylphenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile.
| Compound Name | 2,4,5-trichloro-6-[(2Z)-2-[(2-formylphenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6252079 |
| Molecular Formula | C14H7Cl3N4O |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 2,4,5-trichloro-6-[(2Z)-2-[(2-formylphenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Cl)nc(N/N=C\c2ccccc2C=O)c(Cl)c1Cl |
| InChI | InChI=1S/C14H7Cl3N4O/c15-11-10(5-18)13(17)20-14(12(11)16)21-19-6-8-3-1-2-4-9(8)7-22/h1-4,6-7H,(H,20,21)/b19-6- |
| InChIKey | ICAOBSJEAOHKJS-SWNXQHNESA-N |
| XLogP | 4.17 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|